C12H13F3O2 — CID 102163930
2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxolane (PubChem CID 102163930) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 102163930 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxolane |
| SMILES | FC(F)(F)c1ccc(CCC2OCCO2)cc1 |
| InChI | InChI=1S/C12H13F3O2/c13-12(14,15)10-4-1-9(2-5-10)3-6-11-16-7-8-17-11/h1-2,4-5,11H,3,6-8H2 |
| InChIKey | BDGDPAJWOBSOQY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |