C10H8F2O3 — CID 101393626
4-[difluoro(phenyl)methyl]-1,3-dioxolan-2-one (PubChem CID 101393626) has the molecular formula C10H8F2O3 and a molecular weight of 214.17 g/mol. Its IUPAC name is 4-[difluoro(phenyl)methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[difluoro(phenyl)methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 101393626 |
| Molecular Formula | C10H8F2O3 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 4-[difluoro(phenyl)methyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(C(F)(F)c2ccccc2)O1 |
| InChI | InChI=1S/C10H8F2O3/c11-10(12,7-4-2-1-3-5-7)8-6-14-9(13)15-8/h1-5,8H,6H2 |
| InChIKey | UFVKLEXSLNKULB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |