C13H14F2O3 — CID 166630167
6-[1-(3,4-difluorophenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane (PubChem CID 166630167) has the molecular formula C13H14F2O3 and a molecular weight of 256.25 g/mol. Its IUPAC name is 6-[1-(3,4-difluorophenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane.
| Compound Name | 6-[1-(3,4-difluorophenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 166630167 |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 6-[1-(3,4-difluorophenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane |
| SMILES | C=C(c1ccc(F)c(F)c1)C1COC(C)(C)OO1 |
| InChI | InChI=1S/C13H14F2O3/c1-8(9-4-5-10(14)11(15)6-9)12-7-16-13(2,3)18-17-12/h4-6,12H,1,7H2,2-3H3 |
| InChIKey | WHTVWMJSPHJKRB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|