C26H34N2O6 — CID 102164600
4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-10H-acridin-9-one (PubChem CID 102164600) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-10H-acridin-9-one.
| Compound Name | 4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-10H-acridin-9-one |
|---|---|
| PubChem CID | 102164600 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)-10H-acridin-9-one |
| SMILES | O=c1c2ccccc2[nH]c2c(CN3CCOCCOCCOCCOCCOCC3)cccc12 |
| InChI | InChI=1S/C26H34N2O6/c29-26-22-5-1-2-7-24(22)27-25-21(4-3-6-23(25)26)20-28-8-10-30-12-14-32-16-18-34-19-17-33-15-13-31-11-9-28/h1-7H,8-20H2,(H,27,29) |
| InChIKey | TTYPRXFKLWPJRC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|