C14H22O4 — CID 102165624
(4S,6aR)-2,3-dimethoxy-4-[(E)-4-methoxybut-3-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan (PubChem CID 102165624) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4S,6aR)-2,3-dimethoxy-4-[(E)-4-methoxybut-3-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan.
| Compound Name | (4S,6aR)-2,3-dimethoxy-4-[(E)-4-methoxybut-3-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan |
|---|---|
| PubChem CID | 102165624 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (4S,6aR)-2,3-dimethoxy-4-[(E)-4-methoxybut-3-enyl]-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan |
| SMILES | CO/C=C/CC[C@H]1CC[C@H]2OC(OC)C(OC)=C12 |
| InChI | InChI=1S/C14H22O4/c1-15-9-5-4-6-10-7-8-11-12(10)13(16-2)14(17-3)18-11/h5,9-11,14H,4,6-8H2,1-3H3/b9-5+/t10-,11+,14?/m0/s1 |
| InChIKey | WEKMYAHALZXMKK-KOPRZENTSA-N |
| XLogP | 2.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|