C13H22O4 — CID 135015993
(5S)-2,3-dimethoxy-4-(5-methoxypent-4-enyl)-5-methyl-2,5-dihydrofuran (PubChem CID 135015993) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (5S)-2,3-dimethoxy-4-(5-methoxypent-4-enyl)-5-methyl-2,5-dihydrofuran.
| Compound Name | (5S)-2,3-dimethoxy-4-(5-methoxypent-4-enyl)-5-methyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 135015993 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (5S)-2,3-dimethoxy-4-(5-methoxypent-4-enyl)-5-methyl-2,5-dihydrofuran |
| SMILES | COC=CCCCC1=C(OC)C(OC)O[C@H]1C |
| InChI | InChI=1S/C13H22O4/c1-10-11(8-6-5-7-9-14-2)12(15-3)13(16-4)17-10/h7,9-10,13H,5-6,8H2,1-4H3/t10-,13?/m0/s1 |
| InChIKey | ZFXLZIVJOKNVFW-NKUHCKNESA-N |
| XLogP | 2.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|