C13H24O4 — CID 11368546
5-hexyl-2,4,5-trimethoxy-2H-furan (PubChem CID 11368546) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 5-hexyl-2,4,5-trimethoxy-2H-furan.
| Compound Name | 5-hexyl-2,4,5-trimethoxy-2H-furan |
|---|---|
| PubChem CID | 11368546 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 5-hexyl-2,4,5-trimethoxy-2H-furan |
| SMILES | CCCCCCC1(OC)OC(OC)C=C1OC |
| InChI | InChI=1S/C13H24O4/c1-5-6-7-8-9-13(16-4)11(14-2)10-12(15-3)17-13/h10,12H,5-9H2,1-4H3 |
| InChIKey | ZRJBRBYLLXVZNU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|