C41H72O2 — CID 143991944
(4E)-4-ethylidene-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane (PubChem CID 143991944) has the molecular formula C41H72O2 and a molecular weight of 597.03 g/mol. Its IUPAC name is (4E)-4-ethylidene-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane.
| Compound Name | (4E)-4-ethylidene-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 143991944 |
| Molecular Formula | C41H72O2 |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.55 |
| IUPAC Name | (4E)-4-ethylidene-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolane |
| SMILES | C/C=C1\COC(CCCCCCCC/C=C\C/C=C\CCCCC)(CCCCCCCC/C=C\C/C=C\CCCCC)O1 |
| InChI | InChI=1S/C41H72O2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(42-39-40(6-3)43-41)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h6,13-16,19-22H,4-5,7-12,17-18,23-39H2,1-3H3/b15-13-,16-14-,21-19-,22-20-,40-6+ |
| InChIKey | ZDVOWKKGTWQNDF-ZAJWNVTCSA-N |
| XLogP | 14.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|