C17H32O3 — CID 102055857
3-(methoxymethoxy)-2-undecyl-2,5-dihydrofuran (PubChem CID 102055857) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 3-(methoxymethoxy)-2-undecyl-2,5-dihydrofuran.
| Compound Name | 3-(methoxymethoxy)-2-undecyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 102055857 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 3-(methoxymethoxy)-2-undecyl-2,5-dihydrofuran |
| SMILES | CCCCCCCCCCCC1OCC=C1OCOC |
| InChI | InChI=1S/C17H32O3/c1-3-4-5-6-7-8-9-10-11-12-16-17(13-14-19-16)20-15-18-2/h13,16H,3-12,14-15H2,1-2H3 |
| InChIKey | IMYXQSIONVMEGX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|