C18H30O3 — CID 134920269
(13E)-2,2-diethoxy-5,6,7,8,9,10,11,12-octahydro-4H-cyclododeca[b]furan (PubChem CID 134920269) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (13E)-2,2-diethoxy-5,6,7,8,9,10,11,12-octahydro-4H-cyclododeca[b]furan.
| Compound Name | (13E)-2,2-diethoxy-5,6,7,8,9,10,11,12-octahydro-4H-cyclododeca[b]furan |
|---|---|
| PubChem CID | 134920269 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (13E)-2,2-diethoxy-5,6,7,8,9,10,11,12-octahydro-4H-cyclododeca[b]furan |
| SMILES | CCOC1(OCC)C=C2CCCCCCCCC/C=C\2O1 |
| InChI | InChI=1S/C18H30O3/c1-3-19-18(20-4-2)15-16-13-11-9-7-5-6-8-10-12-14-17(16)21-18/h14-15H,3-13H2,1-2H3/b17-14+ |
| InChIKey | GEDALVKBSQEYCG-SAPNQHFASA-N |
| XLogP | 5.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|