C18H30O — CID 123493230
2,5-dimethyl-6-(2-methylideneheptoxy)octa-1,4,6-triene (PubChem CID 123493230) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,5-dimethyl-6-(2-methylideneheptoxy)octa-1,4,6-triene.
| Compound Name | 2,5-dimethyl-6-(2-methylideneheptoxy)octa-1,4,6-triene |
|---|---|
| PubChem CID | 123493230 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2,5-dimethyl-6-(2-methylideneheptoxy)octa-1,4,6-triene |
| SMILES | C=C(C)CC=C(C)C(=CC)OCC(=C)CCCCC |
| InChI | InChI=1S/C18H30O/c1-7-9-10-11-16(5)14-19-18(8-2)17(6)13-12-15(3)4/h8,13H,3,5,7,9-12,14H2,1-2,4,6H3 |
| InChIKey | VDQINHUWAZHEPQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|