C13H24O2 — CID 14017438
4-methyl-6-octyl-4H-1,3-dioxine (PubChem CID 14017438) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 4-methyl-6-octyl-4H-1,3-dioxine.
| Compound Name | 4-methyl-6-octyl-4H-1,3-dioxine |
|---|---|
| PubChem CID | 14017438 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 4-methyl-6-octyl-4H-1,3-dioxine |
| SMILES | CCCCCCCCC1=CC(C)OCO1 |
| InChI | InChI=1S/C13H24O2/c1-3-4-5-6-7-8-9-13-10-12(2)14-11-15-13/h10,12H,3-9,11H2,1-2H3 |
| InChIKey | DXULBEYJCRFICP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|