About 4-methyl-6-octyl-4H-1,3-dioxine
4-methyl-6-octyl-4H-1,3-dioxine (PubChem CID 14017438) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 4-methyl-6-octyl-4H-1,3-dioxine.
Molecular Properties
| Compound Name | 4-methyl-6-octyl-4H-1,3-dioxine |
| PubChem CID | 14017438 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 4-methyl-6-octyl-4H-1,3-dioxine |
| SMILES | CCCCCCCCC1=CC(C)OCO1 |
| InChI | InChI=1S/C13H24O2/c1-3-4-5-6-7-8-9-13-10-12(2)14-11-15-13/h10,12H,3-9,11H2,1-2H3 |
| InChIKey | DXULBEYJCRFICP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-6-octyl-4H-1,3-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-octyl-4H-1,3-dioxine?
The IUPAC name of 4-methyl-6-octyl-4H-1,3-dioxine (CID 14017438) is 4-methyl-6-octyl-4H-1,3-dioxine.
What is the SMILES notation for 4-methyl-6-octyl-4H-1,3-dioxine?
The canonical SMILES for 4-methyl-6-octyl-4H-1,3-dioxine is CCCCCCCCC1=CC(C)OCO1.
What is the InChIKey of 4-methyl-6-octyl-4H-1,3-dioxine?
The InChIKey is DXULBEYJCRFICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-3-4-5-6-7-8-9-13-10-12(2)14-11-15-13/h10,12H,3-9,11H2,1-2H3.
What are the key properties of 4-methyl-6-octyl-4H-1,3-dioxine?
4-methyl-6-octyl-4H-1,3-dioxine has a molecular weight of 212.33 g/mol, XLogP of 4.01, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-octyl-4H-1,3-dioxine is sourced from PubChem (CID 14017438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).