C14H24O2 — CID 10561126
3-butyl-6-pentyl-2,3-dihydropyran-4-one (PubChem CID 10561126) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 3-butyl-6-pentyl-2,3-dihydropyran-4-one.
| Compound Name | 3-butyl-6-pentyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 10561126 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3-butyl-6-pentyl-2,3-dihydropyran-4-one |
| SMILES | CCCCCC1=CC(=O)C(CCCC)CO1 |
| InChI | InChI=1S/C14H24O2/c1-3-5-7-9-13-10-14(15)12(11-16-13)8-6-4-2/h10,12H,3-9,11H2,1-2H3 |
| InChIKey | GRKZIAZJXMYZNI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|