C16H30O4 — CID 134836323
5-hydroperoxy-3-methoxy-2-undecyl-2,5-dihydrofuran (PubChem CID 134836323) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 5-hydroperoxy-3-methoxy-2-undecyl-2,5-dihydrofuran.
| Compound Name | 5-hydroperoxy-3-methoxy-2-undecyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 134836323 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 5-hydroperoxy-3-methoxy-2-undecyl-2,5-dihydrofuran |
| SMILES | CCCCCCCCCCCC1OC(OO)C=C1OC |
| InChI | InChI=1S/C16H30O4/c1-3-4-5-6-7-8-9-10-11-12-14-15(18-2)13-16(19-14)20-17/h13-14,16-17H,3-12H2,1-2H3 |
| InChIKey | LLWJKNLAKNHCQZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|