C15H28O3 — CID 44605098
(2R,6R)-5,6-diethoxy-2-hexyl-3,6-dihydro-2H-pyran (PubChem CID 44605098) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2R,6R)-5,6-diethoxy-2-hexyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-5,6-diethoxy-2-hexyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 44605098 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (2R,6R)-5,6-diethoxy-2-hexyl-3,6-dihydro-2H-pyran |
| SMILES | CCCCCC[C@@H]1CC=C(OCC)[C@H](OCC)O1 |
| InChI | InChI=1S/C15H28O3/c1-4-7-8-9-10-13-11-12-14(16-5-2)15(18-13)17-6-3/h12-13,15H,4-11H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | UVVZUCLWLBDKLN-UKRRQHHQSA-N |
| XLogP | 4.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|