C15H20O5 — CID 102167287
dimethyl (4E)-3-methylidene-4-(1-prop-2-enoxyethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 102167287) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is dimethyl (4E)-3-methylidene-4-(1-prop-2-enoxyethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-methylidene-4-(1-prop-2-enoxyethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102167287 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | dimethyl (4E)-3-methylidene-4-(1-prop-2-enoxyethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=CCO/C(C)=C1\CC(C(=O)OC)(C(=O)OC)CC1=C |
| InChI | InChI=1S/C15H20O5/c1-6-7-20-11(3)12-9-15(8-10(12)2,13(16)18-4)14(17)19-5/h6H,1-2,7-9H2,3-5H3/b12-11+ |
| InChIKey | JYONRPAYJDKOQD-VAWYXSNFSA-N |
| XLogP | 2.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|