C68H74O8 — CID 102167979
hexyl 4-[3,6,8-tris(4-hexoxycarbonylphenyl)pyren-1-yl]benzoate (PubChem CID 102167979) has the molecular formula C68H74O8 and a molecular weight of 1019.33 g/mol. Its IUPAC name is hexyl 4-[3,6,8-tris(4-hexoxycarbonylphenyl)pyren-1-yl]benzoate.
| Compound Name | hexyl 4-[3,6,8-tris(4-hexoxycarbonylphenyl)pyren-1-yl]benzoate |
|---|---|
| PubChem CID | 102167979 |
| Molecular Formula | C68H74O8 |
| Molecular Weight | 1019.33 g/mol |
| Exact Mass | 1018.54 |
| IUPAC Name | hexyl 4-[3,6,8-tris(4-hexoxycarbonylphenyl)pyren-1-yl]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(-c2cc(-c3ccc(C(=O)OCCCCCC)cc3)c3ccc4c(-c5ccc(C(=O)OCCCCCC)cc5)cc(-c5ccc(C(=O)OCCCCCC)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C68H74O8/c1-5-9-13-17-41-73-65(69)51-29-21-47(22-30-51)59-45-60(48-23-31-52(32-24-48)66(70)74-42-18-14-10-6-2)56-39-40-58-62(50-27-35-54(36-28-50)68(72)76-44-20-16-12-8-4)46-61(57-38-37-55(59)63(56)64(57)58)49-25-33-53(34-26-49)67(71)75-43-19-15-11-7-3/h21-40,45-46H,5-20,41-44H2,1-4H3 |
| InChIKey | RFZXAGOAZSKCMD-UHFFFAOYSA-N |
| XLogP | 18.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.33 |
| LogP ≤ 5 | 18.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|