C34H35NO8 — CID 102168125
diethyl 5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropyl]-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 102168125) has the molecular formula C34H35NO8 and a molecular weight of 585.65 g/mol. Its IUPAC name is diethyl 5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropyl]-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropyl]-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102168125 |
| Molecular Formula | C34H35NO8 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | diethyl 5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropyl]-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2ccc(C[C@H](NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)OC)cc2C1 |
| InChI | InChI=1S/C34H35NO8/c1-4-41-31(37)34(32(38)42-5-2)18-22-15-14-21(16-23(22)19-34)17-29(30(36)40-3)35-33(39)43-20-28-26-12-8-6-10-24(26)25-11-7-9-13-27(25)28/h6-16,28-29H,4-5,17-20H2,1-3H3,(H,35,39)/t29-/m0/s1 |
| InChIKey | MFPXBXQVNPXIBF-LJAQVGFWSA-N |
| XLogP | 4.52 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|