C26H24O5S — CID 10216958
3-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid (PubChem CID 10216958) has the molecular formula C26H24O5S and a molecular weight of 448.54 g/mol. Its IUPAC name is 3-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid.
| Compound Name | 3-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid |
|---|---|
| PubChem CID | 10216958 |
| Molecular Formula | C26H24O5S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 3-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid |
| SMILES | CS(=O)(=O)c1ccc(OCc2ccccc2)c(C2=C(c3cccc(C(=O)O)c3)CCC2)c1 |
| InChI | InChI=1S/C26H24O5S/c1-32(29,30)21-13-14-25(31-17-18-7-3-2-4-8-18)24(16-21)23-12-6-11-22(23)19-9-5-10-20(15-19)26(27)28/h2-5,7-10,13-16H,6,11-12,17H2,1H3,(H,27,28) |
| InChIKey | AVURIILTXHUFQX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|