C17H13NO4S — CID 102169821
(5Z)-3-(4-methylbenzoyl)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 102169821) has the molecular formula C17H13NO4S and a molecular weight of 327.36 g/mol. Its IUPAC name is (5Z)-3-(4-methylbenzoyl)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(4-methylbenzoyl)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 102169821 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (5Z)-3-(4-methylbenzoyl)-5-[(5-methylfuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)N2C(=O)S/C(=C\c3ccc(C)o3)C2=O)cc1 |
| InChI | InChI=1S/C17H13NO4S/c1-10-3-6-12(7-4-10)15(19)18-16(20)14(23-17(18)21)9-13-8-5-11(2)22-13/h3-9H,1-2H3/b14-9- |
| InChIKey | GPMYLJJTBXNKCB-ZROIWOOFSA-N |
| XLogP | 3.77 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|