C7H10O4 — CID 102170349
(3R,4aS,7aS)-3-methyl-4,4a,7,7a-tetrahydro-3H-furo[3,2-c][1,2]dioxin-6-one (PubChem CID 102170349) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (3R,4aS,7aS)-3-methyl-4,4a,7,7a-tetrahydro-3H-furo[3,2-c][1,2]dioxin-6-one.
| Compound Name | (3R,4aS,7aS)-3-methyl-4,4a,7,7a-tetrahydro-3H-furo[3,2-c][1,2]dioxin-6-one |
|---|---|
| PubChem CID | 102170349 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (3R,4aS,7aS)-3-methyl-4,4a,7,7a-tetrahydro-3H-furo[3,2-c][1,2]dioxin-6-one |
| SMILES | C[C@@H]1C[C@@H]2OC(=O)C[C@@H]2OO1 |
| InChI | InChI=1S/C7H10O4/c1-4-2-5-6(11-10-4)3-7(8)9-5/h4-6H,2-3H2,1H3/t4-,5+,6+/m1/s1 |
| InChIKey | LHGUEWNNCZTICD-SRQIZXRXSA-N |
| XLogP | 0.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|