C19H25NO4 — CID 102170504
methyl (2R)-2-[[(2R,4R)-2-(2-methylprop-1-enyl)oxane-4-carbonyl]amino]-2-phenylacetate (PubChem CID 102170504) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R,4R)-2-(2-methylprop-1-enyl)oxane-4-carbonyl]amino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[[(2R,4R)-2-(2-methylprop-1-enyl)oxane-4-carbonyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 102170504 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl (2R)-2-[[(2R,4R)-2-(2-methylprop-1-enyl)oxane-4-carbonyl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](NC(=O)[C@@H]1CCO[C@@H](C=C(C)C)C1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-13(2)11-16-12-15(9-10-24-16)18(21)20-17(19(22)23-3)14-7-5-4-6-8-14/h4-8,11,15-17H,9-10,12H2,1-3H3,(H,20,21)/t15-,16+,17-/m1/s1 |
| InChIKey | UTLMIEYEVYLHLN-IXDOHACOSA-N |
| XLogP | 2.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|