C9H20N2 — CID 102170583
1,2-bis(2-methylpropyl)diaziridine (PubChem CID 102170583) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1,2-bis(2-methylpropyl)diaziridine.
| Compound Name | 1,2-bis(2-methylpropyl)diaziridine |
|---|---|
| PubChem CID | 102170583 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1,2-bis(2-methylpropyl)diaziridine |
| SMILES | CC(C)CN1CN1CC(C)C |
| InChI | InChI=1S/C9H20N2/c1-8(2)5-10-7-11(10)6-9(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | CMNBSWYQLMASFF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|