C16H21NO2 — CID 102171844
N-[(3Z)-3-hydroxypenta-1,3-dien-2-yl]-2,2-dimethyl-N-phenylpropanamide (PubChem CID 102171844) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[(3Z)-3-hydroxypenta-1,3-dien-2-yl]-2,2-dimethyl-N-phenylpropanamide.
| Compound Name | N-[(3Z)-3-hydroxypenta-1,3-dien-2-yl]-2,2-dimethyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 102171844 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-[(3Z)-3-hydroxypenta-1,3-dien-2-yl]-2,2-dimethyl-N-phenylpropanamide |
| SMILES | C=C(/C(O)=C/C)N(C(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c1-6-14(18)12(2)17(15(19)16(3,4)5)13-10-8-7-9-11-13/h6-11,18H,2H2,1,3-5H3/b14-6- |
| InChIKey | DWVIEPOSRPUAJO-NSIKDUERSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|