C15H24O3Si — CID 102171919
ethyl (E)-3-[(1R,2S)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)cyclopropyl]but-2-enoate (PubChem CID 102171919) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is ethyl (E)-3-[(1R,2S)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)cyclopropyl]but-2-enoate.
| Compound Name | ethyl (E)-3-[(1R,2S)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)cyclopropyl]but-2-enoate |
|---|---|
| PubChem CID | 102171919 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | ethyl (E)-3-[(1R,2S)-2-(1-hydroxy-3-trimethylsilylprop-2-ynyl)cyclopropyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)[C@@H]1C[C@@H]1C(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H24O3Si/c1-6-18-15(17)9-11(2)12-10-13(12)14(16)7-8-19(3,4)5/h9,12-14,16H,6,10H2,1-5H3/b11-9+/t12-,13-,14?/m0/s1 |
| InChIKey | NQBBOKSJFQLLQN-BMSLBRKHSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|