C32H18N2O4S4 — CID 102172180
1-[4-[8-[4-(2,5-dioxopyrrol-1-yl)phenyl]sulfanylthianthren-2-yl]sulfanylphenyl]pyrrole-2,5-dione (PubChem CID 102172180) has the molecular formula C32H18N2O4S4 and a molecular weight of 622.77 g/mol. Its IUPAC name is 1-[4-[8-[4-(2,5-dioxopyrrol-1-yl)phenyl]sulfanylthianthren-2-yl]sulfanylphenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[8-[4-(2,5-dioxopyrrol-1-yl)phenyl]sulfanylthianthren-2-yl]sulfanylphenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102172180 |
| Molecular Formula | C32H18N2O4S4 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.01 |
| IUPAC Name | 1-[4-[8-[4-(2,5-dioxopyrrol-1-yl)phenyl]sulfanylthianthren-2-yl]sulfanylphenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(Sc2ccc3c(c2)Sc2cc(Sc4ccc(N5C(=O)C=CC5=O)cc4)ccc2S3)cc1 |
| InChI | InChI=1S/C32H18N2O4S4/c35-29-13-14-30(36)33(29)19-1-5-21(6-2-19)39-23-9-11-25-27(17-23)42-28-18-24(10-12-26(28)41-25)40-22-7-3-20(4-8-22)34-31(37)15-16-32(34)38/h1-18H |
| InChIKey | STGNIUJCQWGXKG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|