C14H14BNO5S — CID 102172764
3-[(S)-borono-[(2-thiophen-2-ylacetyl)amino]methyl]benzoic acid (PubChem CID 102172764) has the molecular formula C14H14BNO5S and a molecular weight of 319.15 g/mol. Its IUPAC name is 3-[(S)-borono-[(2-thiophen-2-ylacetyl)amino]methyl]benzoic acid.
| Compound Name | 3-[(S)-borono-[(2-thiophen-2-ylacetyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 102172764 |
| Molecular Formula | C14H14BNO5S |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-[(S)-borono-[(2-thiophen-2-ylacetyl)amino]methyl]benzoic acid |
| SMILES | O=C(Cc1cccs1)N[C@@H](B(O)O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C14H14BNO5S/c17-12(8-11-5-2-6-22-11)16-13(15(20)21)9-3-1-4-10(7-9)14(18)19/h1-7,13,20-21H,8H2,(H,16,17)(H,18,19)/t13-/m1/s1 |
| InChIKey | HQLQTGGLHBYZSA-CYBMUJFWSA-N |
| XLogP | 0.86 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|