C16H18BNO5S — CID 68734226
3-[(2R)-2-borono-2-[(2-thiophen-2-ylacetyl)amino]ethyl]-4-methylbenzoic acid (PubChem CID 68734226) has the molecular formula C16H18BNO5S and a molecular weight of 347.20 g/mol. Its IUPAC name is 3-[(2R)-2-borono-2-[(2-thiophen-2-ylacetyl)amino]ethyl]-4-methylbenzoic acid.
| Compound Name | 3-[(2R)-2-borono-2-[(2-thiophen-2-ylacetyl)amino]ethyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 68734226 |
| Molecular Formula | C16H18BNO5S |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[(2R)-2-borono-2-[(2-thiophen-2-ylacetyl)amino]ethyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C[C@H](NC(=O)Cc1cccs1)B(O)O |
| InChI | InChI=1S/C16H18BNO5S/c1-10-4-5-11(16(20)21)7-12(10)8-14(17(22)23)18-15(19)9-13-3-2-6-24-13/h2-7,14,22-23H,8-9H2,1H3,(H,18,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | JOAHHIHIDZTMTL-AWEZNQCLSA-N |
| XLogP | 1.04 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|