C15H14O2 — CID 102172990
(2S)-2-(2,3-diethynylphenoxy)oxane (PubChem CID 102172990) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2S)-2-(2,3-diethynylphenoxy)oxane.
| Compound Name | (2S)-2-(2,3-diethynylphenoxy)oxane |
|---|---|
| PubChem CID | 102172990 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2S)-2-(2,3-diethynylphenoxy)oxane |
| SMILES | C#Cc1cccc(O[C@H]2CCCCO2)c1C#C |
| InChI | InChI=1S/C15H14O2/c1-3-12-8-7-9-14(13(12)4-2)17-15-10-5-6-11-16-15/h1-2,7-9,15H,5-6,10-11H2/t15-/m0/s1 |
| InChIKey | FBQDKZWECGKGSZ-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|