C30H45NO7 — CID 102173309
(4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-hydroxypentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102173309) has the molecular formula C30H45NO7 and a molecular weight of 531.69 g/mol. Its IUPAC name is (4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-hydroxypentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-hydroxypentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102173309 |
| Molecular Formula | C30H45NO7 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | (4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-hydroxypentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H](O)C[C@@H]1CC[C@H]([C@@H](C)[C@H](O)[C@H](C)[C@@H]2CC[C@H]([C@@H](C)C(=O)N3C(=O)OC[C@H]3c3ccccc3)O2)O1 |
| InChI | InChI=1S/C30H45NO7/c1-5-9-22(32)16-23-12-13-25(37-23)18(2)28(33)19(3)26-14-15-27(38-26)20(4)29(34)31-24(17-36-30(31)35)21-10-7-6-8-11-21/h6-8,10-11,18-20,22-28,32-33H,5,9,12-17H2,1-4H3/t18-,19-,20-,22+,23+,24+,25-,26+,27-,28+/m1/s1 |
| InChIKey | FONPWOVSQXKHNX-NICSXMKTSA-N |
| XLogP | 4.62 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |