C17H28O8 — CID 102174381
(2S,3R,4S,5S)-2-methoxy-4-methyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-3-ol (PubChem CID 102174381) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-methoxy-4-methyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-3-ol.
| Compound Name | (2S,3R,4S,5S)-2-methoxy-4-methyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 102174381 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2S,3R,4S,5S)-2-methoxy-4-methyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-3-ol |
| SMILES | CO[C@H]1O[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C17H28O8/c1-7-8(18)14(19-6)20-9(7)10-11-12(23-16(2,3)22-11)13-15(21-10)25-17(4,5)24-13/h7-15,18H,1-6H3/t7-,8+,9-,10+,11-,12-,13+,14-,15+/m0/s1 |
| InChIKey | BHOZRBGNVPBJHO-ZKGSJSDCSA-N |
| XLogP | 0.75 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |