C28H33FN4O3 — CID 10217678
2-[1-(3-benzyl-4-oxo-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propyl-(4-fluorobenzoyl)amino]-N,N-dimethylethanamine oxide (PubChem CID 10217678) has the molecular formula C28H33FN4O3 and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[1-(3-benzyl-4-oxo-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propyl-(4-fluorobenzoyl)amino]-N,N-dimethylethanamine oxide.
| Compound Name | 2-[1-(3-benzyl-4-oxo-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propyl-(4-fluorobenzoyl)amino]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 10217678 |
| Molecular Formula | C28H33FN4O3 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-[1-(3-benzyl-4-oxo-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propyl-(4-fluorobenzoyl)amino]-N,N-dimethylethanamine oxide |
| SMILES | CCC(c1nc2c(c(=O)n1Cc1ccccc1)CCC2)N(CC[N+](C)(C)[O-])C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H33FN4O3/c1-4-25(31(17-18-33(2,3)36)27(34)21-13-15-22(29)16-14-21)26-30-24-12-8-11-23(24)28(35)32(26)19-20-9-6-5-7-10-20/h5-7,9-10,13-16,25H,4,8,11-12,17-19H2,1-3H3 |
| InChIKey | GEQDWFPSVSMNLE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|