C31H33BrN4O3 — CID 10031312
2-[1-(1-benzyl-6-oxo-5-phenylpyrimidin-2-yl)propyl-(4-bromobenzoyl)amino]-N,N-dimethylethanamine oxide (PubChem CID 10031312) has the molecular formula C31H33BrN4O3 and a molecular weight of 589.53 g/mol. Its IUPAC name is 2-[1-(1-benzyl-6-oxo-5-phenylpyrimidin-2-yl)propyl-(4-bromobenzoyl)amino]-N,N-dimethylethanamine oxide.
| Compound Name | 2-[1-(1-benzyl-6-oxo-5-phenylpyrimidin-2-yl)propyl-(4-bromobenzoyl)amino]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 10031312 |
| Molecular Formula | C31H33BrN4O3 |
| Molecular Weight | 589.53 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 2-[1-(1-benzyl-6-oxo-5-phenylpyrimidin-2-yl)propyl-(4-bromobenzoyl)amino]-N,N-dimethylethanamine oxide |
| SMILES | CCC(c1ncc(-c2ccccc2)c(=O)n1Cc1ccccc1)N(CC[N+](C)(C)[O-])C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H33BrN4O3/c1-4-28(34(19-20-36(2,3)39)30(37)25-15-17-26(32)18-16-25)29-33-21-27(24-13-9-6-10-14-24)31(38)35(29)22-23-11-7-5-8-12-23/h5-18,21,28H,4,19-20,22H2,1-3H3 |
| InChIKey | CRQIWHOPAKLYNM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|