C10H14O4 — CID 102179769
(3'aS,7'aR)-spiro[1,3-dioxolane-2,7'-3,3a,4,5,6,7a-hexahydro-1-benzofuran]-2'-one (PubChem CID 102179769) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3'aS,7'aR)-spiro[1,3-dioxolane-2,7'-3,3a,4,5,6,7a-hexahydro-1-benzofuran]-2'-one.
| Compound Name | (3'aS,7'aR)-spiro[1,3-dioxolane-2,7'-3,3a,4,5,6,7a-hexahydro-1-benzofuran]-2'-one |
|---|---|
| PubChem CID | 102179769 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3'aS,7'aR)-spiro[1,3-dioxolane-2,7'-3,3a,4,5,6,7a-hexahydro-1-benzofuran]-2'-one |
| SMILES | O=C1C[C@@H]2CCCC3(OCCO3)[C@@H]2O1 |
| InChI | InChI=1S/C10H14O4/c11-8-6-7-2-1-3-10(9(7)14-8)12-4-5-13-10/h7,9H,1-6H2/t7-,9+/m0/s1 |
| InChIKey | NBINYSMAUFZERZ-IONNQARKSA-N |
| XLogP | 0.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |