C24H32F3N5O5S — CID 102180622
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 102180622) has the molecular formula C24H32F3N5O5S and a molecular weight of 559.61 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 102180622 |
| Molecular Formula | C24H32F3N5O5S |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[3-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCCOCCOCCOc1cccc(C2(C(F)(F)F)N=N2)c1 |
| InChI | InChI=1S/C24H32F3N5O5S/c25-24(26,27)23(31-32-23)16-4-3-5-17(14-16)37-13-12-36-11-10-35-9-8-28-20(33)7-2-1-6-19-21-18(15-38-19)29-22(34)30-21/h3-5,14,18-19,21H,1-2,6-13,15H2,(H,28,33)(H2,29,30,34)/t18-,19-,21-/m0/s1 |
| InChIKey | SUZZKKNUZGNSOI-ZJOUEHCJSA-N |
| XLogP | 3.12 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|