C23H35N3O4S — CID 88945793
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-(4-propylphenoxy)ethoxy]ethyl]pentanamide (PubChem CID 88945793) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-(4-propylphenoxy)ethoxy]ethyl]pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-(4-propylphenoxy)ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 88945793 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-(4-propylphenoxy)ethoxy]ethyl]pentanamide |
| SMILES | CCCc1ccc(OCCOCCNC(=O)CCCCC2SCC3NC(=O)NC32)cc1 |
| InChI | InChI=1S/C23H35N3O4S/c1-2-5-17-8-10-18(11-9-17)30-15-14-29-13-12-24-21(27)7-4-3-6-20-22-19(16-31-20)25-23(28)26-22/h8-11,19-20,22H,2-7,12-16H2,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | CIBPFFUQYHWUCI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|