C10H17FO4 — CID 102182166
ethyl 2-[(3R)-2-ethoxyoxolan-3-yl]-2-fluoroacetate (PubChem CID 102182166) has the molecular formula C10H17FO4 and a molecular weight of 220.24 g/mol. Its IUPAC name is ethyl 2-[(3R)-2-ethoxyoxolan-3-yl]-2-fluoroacetate.
| Compound Name | ethyl 2-[(3R)-2-ethoxyoxolan-3-yl]-2-fluoroacetate |
|---|---|
| PubChem CID | 102182166 |
| Molecular Formula | C10H17FO4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethyl 2-[(3R)-2-ethoxyoxolan-3-yl]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)[C@@H]1CCOC1OCC |
| InChI | InChI=1S/C10H17FO4/c1-3-13-9(12)8(11)7-5-6-15-10(7)14-4-2/h7-8,10H,3-6H2,1-2H3/t7-,8?,10?/m0/s1 |
| InChIKey | ATEGCFIQVNWKRR-JEUQWKINSA-N |
| XLogP | 1.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |