C34H52O4S4Si2 — CID 102183448
dioctyl 2-[4,5-bis(2-trimethylsilylethynyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102183448) has the molecular formula C34H52O4S4Si2 and a molecular weight of 709.23 g/mol. Its IUPAC name is dioctyl 2-[4,5-bis(2-trimethylsilylethynyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dioctyl 2-[4,5-bis(2-trimethylsilylethynyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102183448 |
| Molecular Formula | C34H52O4S4Si2 |
| Molecular Weight | 709.23 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | dioctyl 2-[4,5-bis(2-trimethylsilylethynyl)-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C(C(=O)OCCCCCCCC)SC(=C2SC(C#C[Si](C)(C)C)=C(C#C[Si](C)(C)C)S2)S1 |
| InChI | InChI=1S/C34H52O4S4Si2/c1-9-11-13-15-17-19-23-37-31(35)29-30(32(36)38-24-20-18-16-14-12-10-2)42-34(41-29)33-39-27(21-25-43(3,4)5)28(40-33)22-26-44(6,7)8/h9-20,23-24H2,1-8H3 |
| InChIKey | QQHBKWHJMGYECX-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.23 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|