C28H36O4S4 — CID 102183449
dioctyl 2-(4,5-diethynyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102183449) has the molecular formula C28H36O4S4 and a molecular weight of 564.86 g/mol. Its IUPAC name is dioctyl 2-(4,5-diethynyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dioctyl 2-(4,5-diethynyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102183449 |
| Molecular Formula | C28H36O4S4 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | dioctyl 2-(4,5-diethynyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | C#CC1=C(C#C)SC(=C2SC(C(=O)OCCCCCCCC)=C(C(=O)OCCCCCCCC)S2)S1 |
| InChI | InChI=1S/C28H36O4S4/c1-5-9-11-13-15-17-19-31-25(29)23-24(26(30)32-20-18-16-14-12-10-6-2)36-28(35-23)27-33-21(7-3)22(8-4)34-27/h3-4H,5-6,9-20H2,1-2H3 |
| InChIKey | QJCIWOLZUSKSJC-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|