C21H20O — CID 102183534
3-butyl-1-(2-phenylethynyl)-1H-isochromene (PubChem CID 102183534) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-butyl-1-(2-phenylethynyl)-1H-isochromene.
| Compound Name | 3-butyl-1-(2-phenylethynyl)-1H-isochromene |
|---|---|
| PubChem CID | 102183534 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-butyl-1-(2-phenylethynyl)-1H-isochromene |
| SMILES | CCCCC1=Cc2ccccc2C(C#Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H20O/c1-2-3-12-19-16-18-11-7-8-13-20(18)21(22-19)15-14-17-9-5-4-6-10-17/h4-11,13,16,21H,2-3,12H2,1H3 |
| InChIKey | YYWZLGQNEQPBHB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|