C18H17ClN2O3 — CID 102184228
(3R,4S)-3-(3-chlorophenyl)-4-(4-nitrophenyl)-1-propan-2-ylazetidin-2-one (PubChem CID 102184228) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is (3R,4S)-3-(3-chlorophenyl)-4-(4-nitrophenyl)-1-propan-2-ylazetidin-2-one.
| Compound Name | (3R,4S)-3-(3-chlorophenyl)-4-(4-nitrophenyl)-1-propan-2-ylazetidin-2-one |
|---|---|
| PubChem CID | 102184228 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (3R,4S)-3-(3-chlorophenyl)-4-(4-nitrophenyl)-1-propan-2-ylazetidin-2-one |
| SMILES | CC(C)N1C(=O)[C@H](c2cccc(Cl)c2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-11(2)20-17(12-6-8-15(9-7-12)21(23)24)16(18(20)22)13-4-3-5-14(19)10-13/h3-11,16-17H,1-2H3/t16-,17-/m1/s1 |
| InChIKey | VZMOGRFREAPGFI-IAGOWNOFSA-N |
| XLogP | 4.32 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|