C13H17NO3 — CID 102185790
(1S)-1-(deuteriomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 102185790) has the molecular formula C13H17NO3 and a molecular weight of 236.29 g/mol. Its IUPAC name is (1S)-1-(deuteriomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1S)-1-(deuteriomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 102185790 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (1S)-1-(deuteriomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | [2H]C[C@H]1c2cc(OC)c(OC)cc2CCN1C=O |
| InChI | InChI=1S/C13H17NO3/c1-9-11-7-13(17-3)12(16-2)6-10(11)4-5-14(9)8-15/h6-9H,4-5H2,1-3H3/t9-/m0/s1/i1D |
| InChIKey | NNLNOAGROPOFBE-CSKQUJALSA-N |
| XLogP | 1.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|