C23H22BNO2 — CID 102185869
1-[2-[(4R)-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine (PubChem CID 102185869) has the molecular formula C23H22BNO2 and a molecular weight of 355.25 g/mol. Its IUPAC name is 1-[2-[(4R)-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine.
| Compound Name | 1-[2-[(4R)-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 102185869 |
| Molecular Formula | C23H22BNO2 |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[2-[(4R)-4-phenyl-1,3,2-dioxaborolan-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine |
| SMILES | C[C@H](/N=C/c1ccccc1B1OC[C@@H](c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C23H22BNO2/c1-18(19-10-4-2-5-11-19)25-16-21-14-8-9-15-22(21)24-26-17-23(27-24)20-12-6-3-7-13-20/h2-16,18,23H,17H2,1H3/b25-16+/t18-,23-/m0/s1 |
| InChIKey | FMPHBHUVLRYRLK-HVHZHASVSA-N |
| XLogP | 4.35 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|