C21H19NO — CID 101237805
(1S,2R)-2-(benzylideneamino)-1,2-diphenylethanol (PubChem CID 101237805) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is (1S,2R)-2-(benzylideneamino)-1,2-diphenylethanol.
| Compound Name | (1S,2R)-2-(benzylideneamino)-1,2-diphenylethanol |
|---|---|
| PubChem CID | 101237805 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (1S,2R)-2-(benzylideneamino)-1,2-diphenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@H](/N=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO/c23-21(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)22-16-17-10-4-1-5-11-17/h1-16,20-21,23H/b22-16+/t20-,21+/m1/s1 |
| InChIKey | GDBSIHIJCJTOMM-IHBFLQOBSA-N |
| XLogP | 4.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|