C14H20O2 — CID 102186056
(4E,6E)-4-(2,2-dimethylpropylidene)-6-ethylidene-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 102186056) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (4E,6E)-4-(2,2-dimethylpropylidene)-6-ethylidene-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (4E,6E)-4-(2,2-dimethylpropylidene)-6-ethylidene-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 102186056 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (4E,6E)-4-(2,2-dimethylpropylidene)-6-ethylidene-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C/C=C1/C(=O)/C(=C/C(C)(C)C)C2COCC12 |
| InChI | InChI=1S/C14H20O2/c1-5-9-11-7-16-8-12(11)10(13(9)15)6-14(2,3)4/h5-6,11-12H,7-8H2,1-4H3/b9-5+,10-6+ |
| InChIKey | CSYHYQBBFYOGQG-NXZHAISVSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|