C25H35NOSi — CID 102186692
4-methoxy-N-[(3E)-7-methyl-1-phenyl-6-trimethylsilylocta-3,6-dienyl]aniline (PubChem CID 102186692) has the molecular formula C25H35NOSi and a molecular weight of 393.65 g/mol. Its IUPAC name is 4-methoxy-N-[(3E)-7-methyl-1-phenyl-6-trimethylsilylocta-3,6-dienyl]aniline.
| Compound Name | 4-methoxy-N-[(3E)-7-methyl-1-phenyl-6-trimethylsilylocta-3,6-dienyl]aniline |
|---|---|
| PubChem CID | 102186692 |
| Molecular Formula | C25H35NOSi |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 4-methoxy-N-[(3E)-7-methyl-1-phenyl-6-trimethylsilylocta-3,6-dienyl]aniline |
| SMILES | COc1ccc(NC(C/C=C/CC(=C(C)C)[Si](C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H35NOSi/c1-20(2)25(28(4,5)6)15-11-10-14-24(21-12-8-7-9-13-21)26-22-16-18-23(27-3)19-17-22/h7-13,16-19,24,26H,14-15H2,1-6H3/b11-10+ |
| InChIKey | SBEJDANNWLMWQF-ZHACJKMWSA-N |
| XLogP | 7.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|