C24H41NO2Si — CID 102186696
(7E,10Z)-5-(4-methoxyanilino)-11-methyl-10-trimethylsilyltrideca-7,10-dien-1-ol (PubChem CID 102186696) has the molecular formula C24H41NO2Si and a molecular weight of 403.68 g/mol. Its IUPAC name is (7E,10Z)-5-(4-methoxyanilino)-11-methyl-10-trimethylsilyltrideca-7,10-dien-1-ol.
| Compound Name | (7E,10Z)-5-(4-methoxyanilino)-11-methyl-10-trimethylsilyltrideca-7,10-dien-1-ol |
|---|---|
| PubChem CID | 102186696 |
| Molecular Formula | C24H41NO2Si |
| Molecular Weight | 403.68 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | (7E,10Z)-5-(4-methoxyanilino)-11-methyl-10-trimethylsilyltrideca-7,10-dien-1-ol |
| SMILES | CC/C(C)=C(/C/C=C/CC(CCCCO)Nc1ccc(OC)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C24H41NO2Si/c1-7-20(2)24(28(4,5)6)14-9-8-12-21(13-10-11-19-26)25-22-15-17-23(27-3)18-16-22/h8-9,15-18,21,25-26H,7,10-14,19H2,1-6H3/b9-8+,24-20- |
| InChIKey | IZTUIXCWFJTERQ-BTFPLGGSSA-N |
| XLogP | 6.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|