About 4-anilinohept-6-en-1-ol
4-anilinohept-6-en-1-ol (PubChem CID 11564698) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-anilinohept-6-en-1-ol.
Molecular Properties
| Compound Name | 4-anilinohept-6-en-1-ol |
| PubChem CID | 11564698 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-anilinohept-6-en-1-ol |
| SMILES | C=CCC(CCCO)Nc1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-2-7-12(10-6-11-15)14-13-8-4-3-5-9-13/h2-5,8-9,12,14-15H,1,6-7,10-11H2 |
| InChIKey | MOCMUXSFOFAQCO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-anilinohept-6-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinohept-6-en-1-ol?
The IUPAC name of 4-anilinohept-6-en-1-ol (CID 11564698) is 4-anilinohept-6-en-1-ol.
What is the SMILES notation for 4-anilinohept-6-en-1-ol?
The canonical SMILES for 4-anilinohept-6-en-1-ol is C=CCC(CCCO)Nc1ccccc1.
What is the InChIKey of 4-anilinohept-6-en-1-ol?
The InChIKey is MOCMUXSFOFAQCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-2-7-12(10-6-11-15)14-13-8-4-3-5-9-13/h2-5,8-9,12,14-15H,1,6-7,10-11H2.
What are the key properties of 4-anilinohept-6-en-1-ol?
4-anilinohept-6-en-1-ol has a molecular weight of 205.30 g/mol, XLogP of 2.82, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinohept-6-en-1-ol is sourced from PubChem (CID 11564698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).