C13H21NO3 — CID 15449406
(2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]pentane-1,5-diol (PubChem CID 15449406) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]pentane-1,5-diol.
| Compound Name | (2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]pentane-1,5-diol |
|---|---|
| PubChem CID | 15449406 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]pentane-1,5-diol |
| SMILES | OCCC[C@@H](CO)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C13H21NO3/c15-8-4-7-12(9-16)14-13(10-17)11-5-2-1-3-6-11/h1-3,5-6,12-17H,4,7-10H2/t12-,13-/m0/s1 |
| InChIKey | JAHFREQJCWJABB-STQMWFEESA-N |
| XLogP | 0.44 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |