C13H16ClN — CID 12026048
4-chloro-N-hepta-1,6-dien-4-ylaniline (PubChem CID 12026048) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 4-chloro-N-hepta-1,6-dien-4-ylaniline.
| Compound Name | 4-chloro-N-hepta-1,6-dien-4-ylaniline |
|---|---|
| PubChem CID | 12026048 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-chloro-N-hepta-1,6-dien-4-ylaniline |
| SMILES | C=CCC(CC=C)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClN/c1-3-5-12(6-4-2)15-13-9-7-11(14)8-10-13/h3-4,7-10,12,15H,1-2,5-6H2 |
| InChIKey | VEXAGTQOKIJLGL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|