About 4-chloro-N-hepta-1,6-dien-4-ylaniline
4-chloro-N-hepta-1,6-dien-4-ylaniline (PubChem CID 12026048) has the molecular formula C13H16ClN
and a molecular weight of 221.73 g/mol. Its IUPAC name is 4-chloro-N-hepta-1,6-dien-4-ylaniline.
Molecular Properties
| Compound Name | 4-chloro-N-hepta-1,6-dien-4-ylaniline |
| PubChem CID | 12026048 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-chloro-N-hepta-1,6-dien-4-ylaniline |
| SMILES | C=CCC(CC=C)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClN/c1-3-5-12(6-4-2)15-13-9-7-11(14)8-10-13/h3-4,7-10,12,15H,1-2,5-6H2 |
| InChIKey | VEXAGTQOKIJLGL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-hepta-1,6-dien-4-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-hepta-1,6-dien-4-ylaniline?
The IUPAC name of 4-chloro-N-hepta-1,6-dien-4-ylaniline (CID 12026048) is 4-chloro-N-hepta-1,6-dien-4-ylaniline.
What is the SMILES notation for 4-chloro-N-hepta-1,6-dien-4-ylaniline?
The canonical SMILES for 4-chloro-N-hepta-1,6-dien-4-ylaniline is C=CCC(CC=C)Nc1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-hepta-1,6-dien-4-ylaniline?
The InChIKey is VEXAGTQOKIJLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN/c1-3-5-12(6-4-2)15-13-9-7-11(14)8-10-13/h3-4,7-10,12,15H,1-2,5-6H2.
What are the key properties of 4-chloro-N-hepta-1,6-dien-4-ylaniline?
4-chloro-N-hepta-1,6-dien-4-ylaniline has a molecular weight of 221.73 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-hepta-1,6-dien-4-ylaniline is sourced from PubChem (CID 12026048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).